ChemNet > CAS > 175137-21-0 4-chloro-7-methylthieno[3,2-d]pyrimidine
175137-21-0 4-chloro-7-methylthieno[3,2-d]pyrimidine
termék neve |
4-chloro-7-methylthieno[3,2-d]pyrimidine |
MF |
C7H5ClN2S |
Molekulatömeg |
184.646 |
InChI |
InChI=1/C7H5ClN2S/c1-4-2-11-6-5(4)9-3-10-7(6)8/h2-3H,1H3 |
CAS-szám |
175137-21-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.445g/cm3 |
Olvadáspont |
124℃ |
Forráspont |
301.3°C at 760 mmHg |
Törésmutató |
1.682 |
Gyulladáspont |
136°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|